Identification |
Name: | oleic acid, compound with 3-methoxypropylamine (1:1) |
Synonyms: | 9-Octadecenoic acid (9Z)-, compd. with 3-methoxy-1-propanamine (1:1);3-Methoxypropylamine oleate;3-Methoxypropylamine, oleic acid salt;Oleic acid, compound with 3-methoxypropylamine (1:1);(9Z)-octadec-9-enoic acid - 3-methoxypropan-1-amine (1:1) |
CAS: | 68214-77-7 |
EINECS: | 269-317-1 |
Molecular Formula: | C22H45NO3 |
Molecular Weight: | 371.5976 |
InChI: | InChI=1/C18H34O2.C4H11NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-6-4-2-3-5/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-5H2,1H3/b10-9-; |
Molecular Structure: |
|
Properties |
Flash Point: | 270.1°C |
Boiling Point: | 360°C at 760 mmHg |
Flash Point: | 270.1°C |
Safety Data |
|
|