Identification |
Name: | oleic acid, compound with N,N-dimethylhexadecylamine (1:1) |
Synonyms: | 9-Octadecenoic acid (9Z)-, compd. with N,N-dimethyl-1-hexadecanamine (1:1);Dimethylpalmitylamine oleate;Oleic acid, compound with N,N-dimethylhexadecylamine (1:1);(9Z)-octadec-9-enoic acid - N,N-dimethylhexadecan-1-amine (1:1) |
CAS: | 70715-10-5 |
EINECS: | 274-813-6 |
Molecular Formula: | C36H73NO2 |
Molecular Weight: | 551.9703 |
InChI: | InChI=1/C18H39N.C18H34O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h4-18H2,1-3H3;9-10H,2-8,11-17H2,1H3,(H,19,20)/b;10-9- |
Molecular Structure: |
 |
Properties |
Flash Point: | 270.1°C |
Boiling Point: | 360°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 270.1°C |
Safety Data |
|
 |