| Identification | |
| Name: | chloroacetic acid, compound with N,N-dimethylformamide (1:1) |
| Synonyms: | Acetic acid, 2-chloro-, compd. with N,N-dimethylformamide (1:1);Chloroacetic acid, N,N-dimethylformamide salt;Acetic acid, chloro-, compd. with N,N-dimethylformamide (1:1);Chloroacetic acid, compound with N,N-dimethylformamide (1:1);chloroacetic acid - N,N-dimethylformamide (1:1) |
| CAS: | 1726-08-5 |
| EINECS: | 217-037-5 |
| Molecular Formula: | C5H10ClNO3 |
| Molecular Weight: | 167.5908 |
| InChI: | InChI=1/C3H7NO.C2H3ClO2/c1-4(2)3-5;3-1-2(4)5/h3H,1-2H3;1H2,(H,4,5) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 57.8°C |
| Boiling Point: | 153°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 57.8°C |
| Safety Data | |
 |
|
