Identification |
Name: | Hexanedioic acid, mixed decyl and octyl esters |
Synonyms: | Bis-ester of adipic acid, octanol-decanol mixture |
CAS: | 68307-93-7 |
EINECS: | 269-615-1 |
Molecular Formula: | C24H46O4 |
Molecular Weight: | 398.623 |
InChI: | InChI=1/C24H46O4/c1-3-5-7-9-11-12-14-18-22-28-24(26)20-16-15-19-23(25)27-21-17-13-10-8-6-4-2/h3-22H2,1-2H3 |
Molecular Structure: |
|
Properties |
Melting Point: | FP: -50 deg C |
Flash Point: | 188.6°C |
Boiling Point: | 220-254 deg C @ 4 mm Hg |
Density: | 0.923g/cm3 |
Flash Point: | 188.6°C |
Safety Data |
|
|