| Identification | |
| Name: | Hexanedioic acid, mixed esters with 2-butoxyethanol and glutaric acid |
| Synonyms: | 70983-57-2;AC1L3JXS;Hexanedioic acid, mixed esters with 2-butoxyethanol and glutaric acid;adipic acid; 2-butoxyethanol; glutaric acid;2-butoxyethanol; hexanedioic acid; pentanedioic acid |
| CAS: | 70983-57-2 |
| Molecular Formula: | C17H32O10 |
| Molecular Weight: | 396.43 |
| InChI: | InChI=1S/C6H10O4.C6H14O2.C5H8O4/c7-5(8)3-1-2-4-6(9)10;1-2-3-5-8-6-4-7;6-4(7)2-1-3-5(8)9/h1-4H2,(H,7,8)(H,9,10);7H,2-6H2,1H3;1-3H2,(H,6,7)(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 338.5°Cat760mmHg |
| Boiling Point: | 338.5°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 338.5°Cat760mmHg |
| Safety Data | |
 |
|
