| Identification |
| Name: | Octanoic acid, reaction products with 2-[(2-aminoethyl)amino]ethanol, acrylic acid alkylated (1:2) |
| Synonyms: | Octanoic acid, reaction products with 2-((2-aminoethyl)amino)ethanol, acrylic acid alkylated (1:2);2-(2-aminoethylamino)ethanol; but-3-en-2-one; heptanoic acid |
| CAS: | 68815-54-3 |
| EINECS: | 272-382-9 |
| Molecular Formula: | C15H32N2O4 |
| Molecular Weight: | 304.4256 |
| InChI: | InChI=1/C7H14O2.C4H12N2O.C4H6O/c1-2-3-4-5-6-7(8)9;5-1-2-6-3-4-7;1-3-4(2)5/h2-6H2,1H3,(H,8,9);6-7H,1-5H2;3H,1H2,2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 99.2°C |
| Boiling Point: | 222.6°C at 760 mmHg |
| Flash Point: | 99.2°C |
| Safety Data |
| |
 |
