| Identification | |
| Name: | D-Mannitol |
| Synonyms: | Resectisol;Osmitrol (TN);Mannistol;(2S,3S,4R,5R)-hexane-1,2,3,4,5,6-hexol;Mannitol, D-;Mannite;D(-)-Mannitol;Mannidex;Manna sugar;Maniton-S;Diosmol;Mannitol (USP);1,2,3,4,5,6-Hexanehexol;Osmosal;Cordycepic acid;NCI-C50362;Mannit;Mannazucker;Isotol;D-Mannit;Mannitol, Powder;Spray-dried mannitol;D-(-)-Mannitol; |
| CAS: | 69-65-8 |
| EINECS: | 200-711-8 |
| Molecular Formula: | C6H14O6 |
| Molecular Weight: | 182.17 |
| InChI: | InChI=1/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5-,6-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.52 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.333 (20 C) |
| Alpha: | 141 o (C= USP-DIRECTIVES) |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | white crystalline powder |
| HS Code: | 29054300 |
| Storage Temperature: | Store at RT. |
| Color: | Orthorhombic needles from alc WHITE, CRYSTALLINE POWDER OR FREE FLOWING GRANULES |
| Usage: | Used in the food industry as anti-caking and free flowing agent, stabilizer, thickener, and non-nutritive sweetener. |
| Safety Data | |
 |
|
