| Identification | |
| Name: | Lysine, hydrochloride(1:1) |
| Synonyms: | DL-Lysine,monohydrochloride;Lysine, monohydrochloride (9CI);Lysine, monohydrochloride,DL- (8CI);DL-Lysine hydrochloride;NSC 46705; |
| CAS: | 70-53-1 |
| EINECS: | 246-229-1 |
| Molecular Formula: | C6H14N2O2.HCl |
| Molecular Weight: | 146.18756 |
| InChI: | InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.125 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | appreciable |
| Solubility: | appreciable |
| Appearance: | solid |
| Specification: | solid Safety Statements:26 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29224100 |
| Storage Temperature: | Store at RT. |
| Color: | Needles from water, hexagonal plates from dilute alcohol Colorless crystals |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
