| Identification | |
| Name: | 4'-Hydroxypropiophenone |
| Synonyms: | Paroxypropione; 4-Hydroxypropiophenone; p-Methylbenzoic Acid Methyl Ether; P-HYDROXYPROPIOPHENONE; P-HYDROXYL PROPIOPHENONE; P-METHOXYACETOPHENONE; PARA METHOXY ACETOPHENONE; VANATONE; 1-(4-hydroxyphenyl)-1-propanon; 1-(4-Hydroxyphenyl)-1-propanone; (4-Hydroxyphenyl)-1-propanone; |
| CAS: | 70-70-2 |
| EINECS: | 200-743-2 |
| Molecular Formula: | C9H10O2 |
| Molecular Weight: | 150.17 |
| InChI: | InChI=1/C9H10O2/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6,10H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.104 g/cm3 |
| Refractive index: | 1.542 |
| Appearance: | white crystals |
| Specification: |
?Paroxypropione (CAS NO.70-70-2) is also named as 1-(4-Hydroxyphenyl)-1-propanone ; 1-(p-Hydroxyphenyl)-1-propanone ; 4-08-00-00441 (Beilstein Handbook Reference) ; 4-Hydroxypropiophenone ; 4-Propionylphenol ; AI3-03719 ; B 360 ;?Ethyl p-hydroxyphenyl ketone ; Frenantol ; Frenohypon ; Frenon ; Frenormon ; H 365 ; Paroxipropiona ; Paroxipropiona [INN-Spanish] ; Paroxon ; Possipione ; Profenone ; Proxiphenon ; Sterofenon ; UNII-X9952001TG ; USAF EK-3302 ; p-Hydroxyphenyl-1-propanone ; p-Hydroxypropiophenone ; p-Oxypropiophenone ; p-Propionylphenol ; p-Propiophenol .?Paroxypropione (CAS NO.70-70-2) is white powder. It is?slightly soluble in water, soluble in boiling water, with alcohol, ether immiscibility. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29145000 |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xn:有害物质‖Xi
|
 |
|
