| Identification | |
| Name: | N-Ethylbenzimidazole |
| Synonyms: | 1-Ethyl-1H-benzoimidazole |
| CAS: | 7035-68-9 |
| Molecular Formula: | C9H10N2 |
| Molecular Weight: | 146.19 |
| InChI: | InChI=1/C9H10N2/c1-2-11-7-10-8-5-3-4-6-9(8)11/h3-7H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 115.4°C |
| Boiling Point: | 267.2°C at 760 mmHg |
| Density: | 1.08g/cm3 |
| Refractive index: | 1.593 |
| Specification: | Safety Statements:36-24/25 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes |
| Flash Point: | 115.4°C |
| Safety Data | |
 |
|
