| Identification |
| Name: | Cyclohexanecarboxylicacid, 4-(1-methylethyl)-, trans- |
| Synonyms: | trans-4-Isopropylcyclohexane carboxylic acid;Cyclohexanecarboxylic acid, 4-isopropyl-, trans-; |
| CAS: | 7077-05-6 |
| EINECS: | 230-375-8 |
| Molecular Formula: | C10H18O2 |
| Molecular Weight: | 170.24872 |
| InChI: | InChI=1S/C10H18O2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h7-9H,3-6H2,1-2H3,(H,11,12) |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 95 oC |
| Density: | 0.996 g/cm3 |
| Water Solubility: | Soluble in alcohol, chloroform and ethyl acetate, but insoluble in water. |
| Solubility: | Soluble in alcohol, chloroform and ethyl acetate, but insoluble in water. |
| Appearance: | White crystalline powder |
| Safety Data |
| |
 |
