| Identification |
| Name: | Benzoic acid, 4-cyano-,ethyl ester |
| Synonyms: | Benzoicacid, p-cyano-, ethyl ester (6CI,7CI,8CI); 4-(Ethoxycarbonyl)benzonitrile;Ethyl 4-cyanobenzoate; Ethyl p-cyanobenzoate; NSC 62689 |
| CAS: | 7153-22-2 |
| EINECS: | 230-500-6 |
| Molecular Formula: | C10H9 N O2 |
| Molecular Weight: | 175.19 |
| InChI: | InChI=1/C10H9NO2/c1-2-13-10(12)9-5-3-8(7-11)4-6-9/h3-6H,2H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.14 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.528 |
| Appearance: | white to light yellow crystalline powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
