| Identification | |
| Name: | Phenol,5-fluoro-2-methoxy- |
| Synonyms: | 5-Fluoro-2-methoxyphenol |
| CAS: | 72955-97-6 |
| Molecular Formula: | C7H7 F O2 |
| Molecular Weight: | 142.13 |
| InChI: | InChI=1/C7H7FO2/c1-10-7-3-2-5(8)4-6(7)9/h2-4,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 111 oC |
| Boiling Point: | 223 oC |
| Density: | 1.224 |
| Refractive index: | 1.511 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 111 oC |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
