| Identification | |
| Name: | Phenol,4-fluoro-2-methoxy- |
| Synonyms: | 2-Methoxy-4-fluorophenol; |
| CAS: | 450-93-1 |
| EINECS: | -0 |
| Molecular Formula: | C7H7FO2 |
| Molecular Weight: | 142.13 |
| InChI: | InChI=1/C7H7FO2/c1-10-7-4-5(8)2-3-6(7)9/h2-4,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2735 |
| Flash Point: | 215? |
| Density: | 1.247 |
| Refractive index: | 1.517 |
| Appearance: | Clear slightly yellow liquid |
| Specification: | Clear slightly yellow liquid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 215? |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
