| Identification | |
| Name: | M-CHLORAMPHENICOL |
| Synonyms: | M-threo-ChloraMphenicol |
| CAS: | 7411-65-6 |
| Molecular Formula: | C11H12Cl2N2O5 |
| Molecular Weight: | 323.131 |
| InChI: | InChI=1/C11H12Cl2N2O5/c12-10(13)11(18)14-8(5-16)9(17)6-2-1-3-7(4-6)15(19)20/h1-4,8-10,16-17H,5H2,(H,14,18)/t8-,9-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 328.2°C |
| Boiling Point: | 619°C at 760 mmHg |
| Density: | 1.547g/cm3 |
| Refractive index: | 1.611 |
| Specification: | usageEng:The D-threo-stereoisomer of the m-nitro analog of (+/-)-Chloramphenicol. Safety Statements:53-45 53:Avoid exposure - obtain special instruction before use 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 328.2°C |
| Usage: | The D-threo-stereoisomer of the m-nitro analog of (+/-)-Chloramphenicol. |
| Safety Data | |
 |
|
