| Identification | |
| Name: | Vinylidene chloride |
| Synonyms: | 1,1-Dichloroethylene; 1,1-dichloroethene single component*standard for |
| CAS: | 75-35-4 |
| EINECS: | 200-864-0 |
| Molecular Formula: | C2H2Cl2 |
| Molecular Weight: | 96.94 |
| InChI: | InChI=1/C2H2Cl2/c1-2(3)4/h1H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1303 |
| Density: | 1.218 |
| Stability: | Stable. Very flammable - note low flash point. Vapour may travel considerable distances to a source of ignition. Incompatible with strong oxidizing agents, alcohols, halides, sopper, aluminium. Rapidly absorbs oxygen from the air and forms explosive peroxides. Light and water promote self-polymerisation. May form explosive mix |
| Refractive index: | n20/D 1.426 |
| Water Solubility: | moderate |
| Solubility: | moderate |
| Appearance: | colourless liquid |
| Specification: | colourless liquid Safety Statements:7-16-29-36/37-46-45 7:Keep container tightly closed 16:Keep away from sources of ignition - No smoking 29:Do not empty into drains 36/37:Wear suitable protective clothing and gloves 46:If swallowed, seek medical advice immediately and show this container or label 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | I |
| Storage Temperature: | 2-8°C |
| Sensitive: | Light Sensitive |
| Color: | Colorless liquid Colorless liquid or gas (above 89 degrees F). |
| Safety Data | |
| Hazard Symbols |
F+:Extremelyflammable
Xn:Harmful
|
 |
|
