| Identification | |
| Name: | Vinylidene Fluoride |
| Synonyms: | 1,1-difluoroethene; 1,1-difluoroethylene; halocarbon 1132a; VDF; vinylidene difluoride; |
| CAS: | 75-38-7 |
| EINECS: | 200-867-7 |
| Molecular Formula: | C2H2F2 |
| Molecular Weight: | 64.03 |
| InChI: | InChI=1/C2H2F2/c1-2(3)4/h1H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1959 2 |
| Density: | -83 |
| Refractive index: | 1.264 |
| Solubility: | Slightly sol in water; sol in alcohol and ether Water solubility = 6.3 cu cm/100 g at 25 deg C and 10 kPa Water solubility = 0.018 g/100 g at 25 deg C and 760 mm Hg Water solubility = 165 ppm at 25 deg C In water, 164.9 mg/L at 25 deg C |
| Appearance: | colorless gas |
| Specification: | Safety Statements:16-7/9 16:Keep away from sources of ignition - No smoking 7/9:Keep container tightly closed and in a well-ventilated place |
| Packinggroup: | O52 |
| Color: | Colorless gas Colorless gas [Note: Shipped as a liquefied compressed gas]. |
| Safety Data | |
| Hazard Symbols |
21%. Toxic by inhalation. TLV: 2.5
|
 |
|
