| Identification | |
| Name: | 1-Methyl-3-piperidinemethanol |
| Synonyms: | (1-Methylpiperidin-3-yl)methanol;3-(Hydroxymethyl)-1-methylpiperidine;3-Hydroxymethyl-N-methylpiperidine;N-Methylpiperidine-3-methanol;NSC 66541;3-Piperidinemethanol,1-methyl-; |
| CAS: | 7583-53-1 |
| EINECS: | 231-488-5 |
| Molecular Formula: | C7H15NO |
| Molecular Weight: | 129.2 |
| InChI: | InChI=1/C7H15NO/c1-8-4-2-3-7(5-8)6-9/h7,9H,2-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.01 |
| Stability: | Stable under normal shipping and handling conditions. |
| Refractive index: | 1.4772-1.4792 |
| Solubility: | Very soluble |
| Appearance: | clear colorless to yellow liquid |
| Specification: |
1-Methyl-3-piperidinemethanol (CAS NO.7583-53-1), its Synonyms are (1-Methyl-3-piperidyl)methanol ; (1-Methylpiperidin-3-yl)methanol ; 3-(Hydroxymethyl)-1-methylpiperidine ; 3-Hydroxymethyl-N-methylpiperidine ; N-Methylpiperidine-3-methanol ; 3-Piperidinemethanol,1-methyl- . |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
