| Identification | |
| Name: | 3-Piperidinemethanol,1-(phenylmethyl)- |
| Synonyms: | 3-Piperidinemethanol,1-benzyl- (6CI);1-Benzyl-3-hydroxymethylpiperidine;1-Benzyl-3-piperidinemethanol; |
| CAS: | 85387-44-6 |
| Molecular Formula: | C13H19NO |
| Molecular Weight: | 205.30 |
| InChI: | InChI=1S/C13H19NO/c15-11-13-7-4-8-14(10-13)9-12-5-2-1-3-6-12/h1-3,5-6,13,15H,4,7-11H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.056 g/cm3 |
| Specification: |
The cas register number of (1-Benzyl-3-piperidinyl)methanol is 85387-44-6. It also can be called as 3-piperidinemethanol, 1-(phenylmethyl)- and the Systematic name about this chemical is (1-benzylpiperidin-3-yl)methanol. Physical properties about (1-Benzyl-3-piperidinyl)methanol are: (1)ACD/LogP: 2.08; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1; (4)ACD/LogD (pH 7.4): 0; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 10; (9)#H bond acceptors: 2; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 23.47Å2; (13)Index of Refraction: 1.551; (14)Molar Refractivity: 62.02 cm3; (15)Molar Volume: 194.389 cm3; (16)Surface Tension: 42.358 dyne/cm; (17)Density: 1.056 g/cm3; (18)Flash Point: 123.378 °C; (19)Enthalpy of Vaporization: 56.36 kJ/mol; (20)Boiling Point: 294.068 °C at 760 mmHg; (21)Vapour Pressure: 0.001 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
