| Identification | |
| Name: | 3-Buten-1-ol, 3-methyl- |
| Synonyms: | 2-Methyl-1-buten-4-ol;2-Methyl-4-hydroxy-1-butene;3-Isopentenyl alcohol;3-Methyl-3-buten-1-ol;3-Methyl-3-butene-1-ol;3-Methyl-3-butenol;3-Methylenebutan-1-ol;4-Hydroxy-2-methyl-1-butene;Isobutenylcarbinol;Isoprenol;Isopropenylethylalcohol;Methallylcarbinol;NSC 122673; |
| CAS: | 763-32-6 |
| EINECS: | 212-110-8 |
| Molecular Formula: | C5H10O |
| Molecular Weight: | 86.13 |
| InChI: | InChI=1/C5H10O/c1-5(2)3-4-6/h6H,1,3-4H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1987 3/PG 3 |
| Density: | 0.85 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.433(lit.) |
| Water Solubility: | Stability Stable. Flammable. Incompatible with strong oxidizing agents. Toxicology Eye, skin and respiratory irritant. Toxicity data (The meaning of any toxicol |
| Solubility: |
|
| Appearance: | clear colorless to light yellow liquid |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
