Identification |
Name: | 2-ethylhexyl thioglycolate |
Synonyms: | 2-ethylhexyl mercaptoacetate; Thioglycolic acid 2-ethylhexyl ester; Isooctyl mercaptoacetate; Isooctyl thiohydroxy acetate; TGB |
CAS: | 7659-86-1 |
EINECS: | 231-626-4 |
Molecular Formula: | C10H20O2S |
Molecular Weight: | 204.3296 |
InChI: | InChI=1S/C10H20O2S/c1-3-5-6-9(4-2)7-12-10(11)8-13/h9,13H,3-8H2,1-2H3 |
Molecular Structure: |
|
Properties |
Transport: | UN 3272 |
Melting Point: | -31
C |
Flash Point: | 112
-114 C |
Density: | 0.972 |
Refractive index: | n20/D 1.461 |
Water Solubility: | Insoluble |
Solubility: | Insoluble |
Appearance: | Clear
liquid |
Specification: | Safety Statements:26-36/37 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37:Wear suitable protective clothing and gloves |
Packinggroup: | III |
HS Code: | 29309070 |
Flash Point: | 112
-114 C |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
|