| Identification | |
| Name: | Dicyclopentadiene |
| Synonyms: | 4,7-Methanoindene,3a,4,7,7a-tetrahydro- (7CI,8CI); 3a,4,7,7a-Tetrahydro-4,7-methano-1H-indene;3a,4,7,7a-Tetrahydro-4,7-methanoindene; Bicyclopentadiene; Biscyclopentadiene;Cyclopentadiene dimer; DCPD 103; Dicyclopentadiene; JP 10; NSC 7352; Prometa XP100; Tricyclo[4.3.1.02,5]deca-3,7-diene; Tricyclo[5.2.1.02,6]deca-3,8-diene;Ultrene |
| CAS: | 77-73-6 |
| EINECS: | 201-052-9 |
| Molecular Formula: | C10H12 |
| Molecular Weight: | 132.2023 |
| InChI: | InChI=1S/C10H12/c1-2-9-7-4-5-8(6-7)10(9)3-1/h1-2,4-5,7-10H,3,6H2/t7?,8?,9-,10+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2048 |
| Density: | 0.982 |
| Stability: | Stable at room temperature, but may form explosive peroxides if stored in contact with air. Incompatible with oxidizing agents. Decomposes on heating. Flammable. Mixtures of the vapour with air are explosive. |
| Refractive index: | 1.51-1.512 |
| Solubility: | Insoluble |
| Appearance: | colourless crystals with a camphor-like odour |
| Specification: | colourless crystals with a camphor-like odour Safety Statements:36/37-61 36/37:Wear suitable protective clothing and gloves 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | III |
| HS Code: | 29021990 |
| Storage Temperature: | Flammables area |
| Color: | Colorless crystalline solid [Note: A liquid above 90 degrees F] |
| Usage: | Monomer for ethylene-propylene terpolymer elastomers, dryer & hardener in linseed & soybean oil, curing agent in other elastomers. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
