| Identification | |
| Name: | Dicyclopentadiene diepoxide |
| Synonyms: | 1,2:5,6-Diepoxyhexahydro-4,7-methanoindane; Dicyclopentadiene dioxide,mixture of endo and exo isomers; Bicyclopentadiene diepoxide |
| CAS: | 81-21-0 |
| EINECS: | 201-334-1 |
| Molecular Formula: | C10H12O2 |
| Molecular Weight: | 164.2 |
| InChI: | InChI=1/C10H12O2/c1-4-3-2-6-10(11-6)7(3)5(1)9-8(4)12-9/h3-10H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Flash Point: | 134.4°C |
| Boiling Point: | 120°C 10mm |
| Density: | 1.331 |
| Refractive index: | 1.614 |
| Solubility: | SOL IN BENZENE 1.4% IN WATER 18.6% IN METHANOL 44.7% IN ACETONE 18.7% IN ETHER |
| Appearance: | white to yellow-beige crystals |
| Specification: |
Bicyclopentadiene dioxide (81-21-0) also can be called Dicyclopentadiene dioxide (VAN) ; Dicyclopentadiene diepoxide ; Epoxide 207 ; 2,4-methano-2H-indeno[1,2-b:5,6-b']bisoxirene, octahydro- ;and 2,4-Methano-2H-bisoxireno[a,f]indene, octahydro- .In addition, Bicyclopentadiene dioxide (81-21-0) is not compatible with strong oxidizing agents, and you must not take it with incompatible materials.And also prevent it to broken down into hazardous decomposition products: carbon dioxide, carbon monoxide. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 134.4°C |
| Color: | WHITE CRYSTALLINE POWDER |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
