| Identification | |
| Name: | Acrylamide |
| Synonyms: | Propenamide; Ethylenecarboxamide; Acrylamide ultra sequencing gel; Acrylamide, Molecular Biology Grade; Acrylamide monomer; Acrylamide-bis premix 37.5:1; Acrylamide electrophoresis; AM |
| CAS: | 79-06-1 |
| EINECS: | 201-173-7 |
| Molecular Formula: | C3H5NO |
| Molecular Weight: | 71.08 |
| InChI: | InChI=1/C3H5NO/c1-2-3(4)5/h2H,1H2,(H2,4,5) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2074 |
| Density: | 1.1 |
| Stability: | Unstable. Do not heat above 50C. Explosive. Incompatible with acids, bases, oxidizing agents, reducing agents, iron and iron salts, copper, aluminium, brass, free radical initiators. Air sensitive. Hygroscopic. |
| Refractive index: | 1.460 |
| Water Solubility: | SOLUBLE, 216 g/100 mL |
| Appearance: | white crystals |
| Packinggroup: | III |
| HS Code: | 29241900 |
| Sensitive: | Light Sensitive |
| Color: | WHITE SOLID |
| Usage: | Used for sewage and waste treatment, to make dyes, adhesives. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
