| Identification | |
| Name: | 1,1,2,2-Tetrabromoethane |
| Synonyms: | 1,1,2,2-tetrabromoethylene; ACETYLENE DICHLORIDE (TETRABROMOETHANE); Acetylene tetrabromide; muthmann's liquid; s-Tetrabromoethane; sym-Tetrabromoethane; TBE; Tetrabromoacetylene; tetrabromoethane |
| CAS: | 79-27-6 |
| EINECS: | 201-191-5 |
| Molecular Formula: | C2H2Br4 |
| Molecular Weight: | 345.65 |
| InChI: | InChI=1/C2H2Br4/c3-1(4)2(5)6/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2504 |
| Density: | 2.966 |
| Stability: | Stable. Incompatible with strong oxidizing agents, aluminium, magnesium, alkali metals. |
| Refractive index: | 1.636-1.638 |
| Solubility: | 0.63 g/L (20 oC) in water |
| Appearance: | Colorless to yellowish liquid. |
| Packinggroup: | III |
| HS Code: | 29033036 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep away from metals. |
| Color: | Yellowish, heavy liquid /SRP: technical grade/ Colorless to yellow liquid Pale-yellow liquid [Note: A solid below 32 degrees F]. |
| Usage: | Separating minerals by specific gravity, solvent for fats, oils, and waxes, solvent in microscopy. |
| Safety Data | |
| Hazard Symbols |
T+:Verytoxic
|
 |
|
