| Identification | |
| Name: | Diphenyl N-cyanocarbonimidate |
| Synonyms: | Carbonimidicacid, cyano-, diphenyl ester (9CI);Diphenoxymethylenecyanamide;DiphenylN-cyanocarbonimidate;Diphenyl N-cyanoimidocarbonate;Diphenylcyanocarbonimidate; |
| CAS: | 79463-77-7 |
| EINECS: | 427-300-8 |
| Molecular Formula: | C14H10N2O2 |
| Molecular Weight: | 238.2414 |
| InChI: | InChI=1/C14H10N2O2/c15-11-16-14(17-12-7-3-1-4-8-12)18-13-9-5-2-6-10-13/h1-10H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3439 |
| Density: | 1.1 g/cm3 |
| Refractive index: | 1.56 |
| Appearance: | white fluffy powder |
| Specification: |
Diphenyl N-cyanocarbonimidate , with CAS number of 79463-77-7, can be called Carbonimidic acid, cyano-, diphenyl ester ; carbonimidic acid, N-cyano-, diphenyl ester . It is a white fluffy powder. |
| Packinggroup: | III |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
