| Identification | |
| Name: | Copper oxalate |
| Synonyms: | Copperoxalate (CuC2O4) (6CI);Copper, [ethanedioato(2-)-O,O']-;Oxalic acid,copper(2+) salt (1:1) (8CI); |
| CAS: | 814-91-5 |
| EINECS: | 212-411-4 |
| Molecular Formula: | CuC2O4 |
| Molecular Weight: | 151.56 |
| InChI: | InChI=1/C2H2O4.Cu/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+2/p-2 |
| Molecular Structure: | ![(CuC2O4) Copperoxalate (CuC2O4) (6CI);Copper, [ethanedioato(2-)-O,O']-;Oxalic acid,copper(2+) salt (1:1) (8CI...](https://img.guidechem.com/casimg/814-91-5.gif) |
| Properties | |
| Transport: | UN 2449 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble in water |
| Appearance: | odorless bluish-white solid |
| Specification: |
Copper oxalate (CAS NO.814-91-5) is also named as Caswell No. 248A ; Copper oxalate (CuC2O4) ; Copper(II) oxalate ; Cupric oxalate ; Cupric oxalate (1:1) ; EPA Pesticide Chemical Code 023305 ; Ethanedioic acid copper salt ; Ethanedioic acid, copper(2+) salt (1:1) ; HSDB 265 ; NSC 112246 ; NSC 86015 ; Oxalic acid copper(2+) salt (1:1) ; Copper, (ethanedioato(2-)-kappaO1,kappaO2)- . Copper oxalate (CAS NO.814-91-5) is odorless bluish-white solid. Cupric oxalate dissolves in aqueous ammonia and reacts as an acid to neutralize other bases as well. It can serve as a reducing agent in reactions that generate carbon dioxide. Inhalation causes irritation of nose and throat. Ingestion of very large amounts may produce symptoms of oxalate poisoning; watch for edema of the glottis and delayed constriction of esophagus. Contact with eyes causes irritation. It may form toxic carbon monoxide gas in fire. |
| Packinggroup: | III |
| Color: | Blue-white powder Bluish-green powder |
| Safety Data | |
 |
|
