| Identification | |
| Name: | barium oxalate |
| Synonyms: | Puratronic,99.999% (metals basis); Puratronic |
| CAS: | 516-02-9 |
| EINECS: | 208-216-9 |
| Molecular Formula: | BaC2O4 |
| Molecular Weight: | 225.346 |
| InChI: | InChI=1S/C2H2O4.Ba/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+2/p-2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1564 |
| Density: | 2.66 |
| Water Solubility: | soluble in water |
| Solubility: | soluble in water |
| Appearance: | White Powder |
| Specification: | White Powder Safety Statements:28 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) |
| Packinggroup: | II |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
