| Identification | |
| Name: | 1,3-dibromo-2-propanone |
| Synonyms: | 1,3-Dibromoacetone;Bis(bromomethyl) ketone;2-propanone, 1,3-dibromo-; |
| CAS: | 816-39-7 |
| EINECS: | 212-430-8 |
| Molecular Formula: | C3H4Br2O |
| Molecular Weight: | 215.872 |
| InChI: | InChI=1/C3H4Br2O/c4-1-3(6)2-5/h1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2927 |
| Density: | 2.125 g/cm3 |
| Refractive index: | 1.5470 |
| Appearance: | yellow to dark brown liquid |
| Specification: |
1,3-dibromo-2-propanone , with CAS number of 816-39-7, can be called 1,3-Dibromoacetone ; Bis(bromomethyl) ketone ; 2-propanone, 1,3-dibromo- . It is a yellow to dark brown liquid. |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
