| Identification |
| Name: | Benzene,2-(chloromethyl)-1,4-dimethyl- |
| Synonyms: | (Chloromethyl)-p-xylene;1,4-Dimethyl-2-chloromethylbenzene;1-(Chloromethyl)-2,5-dimethylbenzene;2-Chloromethyl-1,4-dimethylbenzene;2-Chloromethyl-p-xylene;NSC 133437; |
| CAS: | 824-45-3 |
| EINECS: | 212-529-6 |
| Molecular Formula: | C9H11Cl |
| Molecular Weight: | 154.64 |
| InChI: | InChI=1/C9H11Cl/c1-7-3-4-8(2)9(5-7)6-10/h3-5H,6H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 |
| Density: | 1.046 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5364-1.5384 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Clear, colorless liquid. Chlorine-like odor. |
| Packinggroup: | II |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
