| Identification | |
| Name: | Phenol,4-(trans-4-pentylcyclohexyl)- |
| Synonyms: | Phenol,4-(4-pentylcyclohexyl)-, trans-;p-(trans-4-Pentylcyclohexyl)phenol;p-(trans-4-n-Pentylcyclohexyl)phenol;trans-(4-Pentylcyclohexyl)phenol;PCH 500; |
| CAS: | 82575-69-7 |
| Molecular Formula: | C17H26O |
| Molecular Weight: | 246.39 |
| InChI: | InChI=1/C17H26O/c1-2-3-4-5-14-6-8-15(9-7-14)16-10-12-17(18)13-11-16/h10-15,18H,2-9H2,1H3/t14-,15- |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.961 g/cm3 |
| Refractive index: | 1.514 |
| Specification: |
4-(trans-4-Pentylcyclohexyl)phenol , its cas register number is 82575-69-7. It also can be called P-(trans-4-pentylcyclohexyl)phenol ; 4-(trans-4-n-pentylcyclohexyl)phenol ; 4-pentyl-cyclohexyl phenol ; 4-(4''-n-pentylcyclohexyl)phenol ; 4-(trans-4-pentylcyclohexyl)phenol ; trans-4-(4-pentylcyclohexyl)-1-hydroxybenzene . 4-(trans-4-Pentylcyclohexyl)phenol (CAS NO.82575-69-7) has been used for intermediate of liquid crystal. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
 |
|
