| Identification |
| Name: | Benzenepropanamine,N-methyl-gamma-(2-methylphenoxy)-, (gammaR)- |
| Synonyms: | Benzenepropanamine,N-methyl-g-(2-methylphenoxy)-, (R)-;(-)-Tomoxetine;Atomoxetine;Tomoxetine; |
| CAS: | 83015-26-3 |
| Molecular Formula: | C17H21NO |
| Molecular Weight: | 255.36 |
| InChI: | InChI=1/C17H21NO/c1-14-8-6-7-11-16(14)19-17(12-13-18-2)15-9-4-3-5-10-15/h3-11,17-18H,12-13H2,1-2H3/t17-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 164.1°C |
| Boiling Point: | 389°C at 760 mmHg |
| Density: | 1.023g/cm3 |
| Refractive index: | 1.552 |
| Flash Point: | 164.1°C |
| Usage: | A compound active at novel site on receptor-operated calcium channels useful for treatment of neurological disorders and diseases. |
| Safety Data |
| |
 |
