| Identification | |
| Name: | Benzoicacid, 2-(4-chlorobenzoyl)- |
| Synonyms: | Benzoicacid, o-(p-chlorobenzoyl)- (6CI,7CI,8CI);2-(p-Chlorobenzoyl)benzoic acid;4-Chlorobenzophenone-2'-carboxylic acid;NSC7825;o-(4-Chlorobenzoyl)benzoic acid;o-(p-Chlorobenzoyl)benzoic acid; |
| CAS: | 85-56-3 |
| EINECS: | 201-615-9 |
| Molecular Formula: | C14H9ClO3 |
| Molecular Weight: | 260.68 |
| InChI: | InChI=1/C14H9ClO3/c15-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)14(17)18/h1-8H,(H,17,18) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.357 g/cm3 |
| Refractive index: | 1.624 |
| Specification: | White Solid Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Storage Temperature: | Refrigerator |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
