| Identification |
| Name: | 1,2-Benzenedicarboxylicacid, 1-(2-ethoxy-2-oxoethyl) 2-methyl ester |
| Synonyms: | 1,2-Benzenedicarboxylicacid, 2-ethoxy-2-oxoethyl methyl ester (9CI); Phthalic acid, methyl ester,ester with ethyl glycolate (6CI,7CI,8CI); Glycolic acid, ethyl ester, methylphthalate (8CI); Ethoxycarbonylmethyl methyl phthalate; EthylO-[o-(methoxycarbonyl)benzoyl]glycolate; Methyl carbethoxymethyl phthalate;Methyl phthalyl ethyl glycolate; NSC 4836; Santicizer M-17 |
| CAS: | 85-71-2 |
| EINECS: | 201-625-3 |
| Molecular Formula: | C13H14 O6 |
| Molecular Weight: | 266.27 |
| InChI: | InChI=1/C13H14O6/c1-3-18-11(14)8-19-13(16)10-7-5-4-6-9(10)12(15)17-2/h4-7H,3,8H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 158°C |
| Boiling Point: | 360.1°C at 760 mmHg |
| Density: | 1.22g/cm3 |
| Refractive index: | 1.511 |
| Specification: |
Methyl phthalyl ethyl glycolate (CAS NO.85-71-2) is also called (Ethoxycarbonyl)methyl phthalate ; 4-09-00-03256 (Beilstein Handbook Reference) ; AI3-01792 ; BRN 1995396 ; Ethoxycarbonylmethyl methyl phthalate ; Ethoxykarbonylmethyl-methylester kyseliny ftalove ; Ethyl O-(o-(methoxycarbonyl)benzoyl)glycolate ; Ethyl o-(methoxycarbonyl)benzoyloxyacetate ; Ethyl o-(o-(methoxycarbonyl)benzoyl)glycolate ; Glycolic acid, ethyl ester, methyl phthalate ; Methyl carbethoxymethyl phthalate ; NSC 4836 ; Phthalic acid, monomethyl ester, ester with ethyl glycolate ; Santicizer M-17 .
|
| Flash Point: | 158°C |
| Safety Data |
| |
 |