| Identification | |
| Name: | 4-Thiazolecarboxylicacid, 2-amino-5-bromo-, methyl ester |
| Synonyms: | Methyl2-amino-5-bromothiazole-4-carboxylate |
| CAS: | 850429-60-6 |
| Molecular Formula: | C5H5 Br N2 O2 S |
| Molecular Weight: | 237.07 |
| InChI: | InChI=1/C5H5BrN2O2S/c1-10-4(9)2-3(6)11-5(7)8-2/h1H3,(H2,7,8) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.844 g/cm3 |
| Refractive index: | 1.642 |
| Specification: |
Methyl 2-amino-5-bromothiazole-4-carboxylate , with CAS number of 850429-60-6, can be called 2-Amino-5-bromothiazole-4-carboxylic acid methyl ester ; Methyl 2-amino-5-bromo-4-thiazolecarboxylate ; Methyl 2-amino-5-bromothiazole-4-carboxylat ; Methyl 2-amino-5-bromo-1,3-thiazole-4-carboxylate 95% ; 4-Thiazolecarboxylicacid,2-amino-5-bromo-,methylester(9CI) . |
| Safety Data | |
 |
|
