| Identification | |
| Name: | 4-Thiazolecarboxylicacid, 5-bromo-, methyl ester |
| Synonyms: | Methyl5-bromothiazole-4-carboxylate |
| CAS: | 913836-22-3 |
| Molecular Formula: | C5H4 Br N O2 S |
| Molecular Weight: | 222.0616 |
| InChI: | InChI=1/C5H4BrNO2S/c1-9-5(8)3-4(6)10-2-7-3/h2H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 98-101 |
| Flash Point: | 120.7°C |
| Boiling Point: | 276°C at 760 mmHg |
| Density: | 1.759g/cm3 |
| Refractive index: | 1.583 |
| Specification: |
4-Thiazolecarboxylicacid, 5-bromo-, methyl ester , with CAS number of 913836-22-3, can be called Methyl 5-bromo-1,3-thiazole-4-carboxylate ; Methyl 5-bromo-1,3-thiazole-4-carboxylate 97% ; Methyl 5-bromo-4-thiazolecarboxylate ; Methyl 5-bromothiazole-4-carboxylate . |
| Flash Point: | 120.7°C |
| Storage Temperature: | Keep Cold |
| Safety Data | |
 |
|
