| Identification | |
| Name: | 2-Chloro-6-methylaniline |
| Synonyms: | 6-chloro-o-toluidine; 2-Amino-3-chlorotoluene |
| CAS: | 87-63-8 |
| EINECS: | 201-759-2 |
| Molecular Formula: | C7H8ClN |
| Molecular Weight: | 141.6 |
| InChI: | InChI=1/C7H8ClN/c1-5-3-2-4-6(8)7(5)9/h2-4H,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2239/3429 |
| Density: | 1.152 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.575-1.578 |
| Water Solubility: | Immiscible |
| Solubility: | Immiscible |
| Appearance: | clear yellow to red-brown liquid |
| Specification: |
? 2-Amino-3-chlorotoluene , with CAS number of 87-63-8, can be called 2-Chloro-6-methylaniline ; 2-Methyl-6-chloroaniline ; 6-Chloro-2-methylaniline ; 6-Chloro-2-toluidine ; 6-Chloro-o-toluidine .?It is a?clear yellow to red-brown liquid.? 2-Amino-3-chlorotoluene (CAS NO.87-63-8) can be used as a medicine, pesticide, dye intermediate. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat and flame. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
