| Identification | |
| Name: | 4-Chlorobenzyl alcohol |
| Synonyms: | (4-Chlorophenyl)methanol |
| CAS: | 873-76-7 |
| EINECS: | 212-852-2 |
| Molecular Formula: | C7H7ClO |
| Molecular Weight: | 142.58 |
| InChI: | InChI=1/C7H7ClO/c8-7-3-1-6(5-9)2-4-7/h1-4,9H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.237 g/cm3 |
| Stability: | Stable. Incompatible with acid chlorides, acid anhydrides, acids, oxidizing agents. Combustible. |
| Refractive index: | 1.566 |
| Appearance: | almost white powder |
| Specification: |
The extinguishing agent of 4-Chlorobenzyl alcohol (CAS No.873-76-7) are dry powder, foam, sand, carbon dioxide, water mist. |
| HS Code: | 29062900 |
| Storage Temperature: | Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
