| Identification | |
| Name: | 4-Nitrobenzyl alcohol |
| Synonyms: | p-Nitrobenzyl alcohol;p-(Hydroxymethyl)nitrobenzene;(4-Nitrophenyl)methanol;4-Nitrobenzenemethanol;4-06-00-02611 (Beilstein Handbook Reference); |
| CAS: | 619-73-8 |
| EINECS: | 210-611-6 |
| Molecular Formula: | C7H7NO3 |
| Molecular Weight: | 153.14 |
| InChI: | InChI=1/C7H7NO3/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4,9H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.33g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.597 |
| Solubility: | Slightly soluble |
| Appearance: | Light yellow to yellow powder. |
| Specification: |
?(4-Nitrophenyl)methanol , with CAS number of 619-73-8, can be called (4-Nitrophenyl)methanol ; 4-Nitrobenzenemethanol ; 4-Nitrobenzyl alcohol ; p-(Hydroxymethyl)nitrobenzene ; p-Nitrobenzyl alcohol . |
| HS Code: | 29062900 |
| Storage Temperature: | Store at RT. |
| Safety Data | |
| Hazard Symbols | |
 |
|
