Identification |
Name: | 1-Butanol,4-amino-2-methyl-, (2R)- |
Synonyms: | 1-Butanol,4-amino-2-methyl-, (R)-; (R)-4-Amino-2-methylbutan-1-ol |
CAS: | 88390-32-3 |
Molecular Formula: | C5H13 N O |
Molecular Weight: | 103.16 |
InChI: | InChI=1/C5H13NO/c1-5(4-7)2-3-6/h5,7H,2-4,6H2,1H3/t5-/m1/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 59.446°C |
Boiling Point: | 80 °C / 1.8mmHg |
Density: | 0,94 g/cm3 |
Refractive index: | 14.5 ° (C=neat) |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 59.446°C |
Safety Data |
|
|