| Identification | |
| Name: | 2-Propenoic acid, ethylester, homopolymer |
| Synonyms: | Acrylicacid ethyl ester, polymers (8CI); Acrilem RP 6005; Acrylic acid ethyl esterpolymer; Arufon UP 1010; CP 31; Ethyl acrylate copolymers; Ethyl acrylatehomopolymer; Ethyl acrylate polymer; Ethyl acrylate polymers; F 931-9048;Fluorolux 7709; National Starch 254290; National Starch 2892; Plexigum B;Plexisol B 372; Plexisol B 574; Plexisol BV 396; Plextol BV 405; Plextol BV411; Poly(ethyl acrylate); RA 2; RA 2 (acrylic polymer); Resyn 2892; UP 1010; X4460 |
| CAS: | 9003-32-1 |
| Molecular Formula: | C5 H8 O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C5H8O2/c1-3-5(6)7-4-2/h3H,1,4H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 3/PG 2 |
| Melting Point: | -71.2 deg C |
| Flash Point: | 15.6°C |
| Boiling Point: | 99.5°Cat760mmHg |
| Density: | 0.913g/cm3 |
| Refractive index: | n20/D 1.469 |
| Solubility: | Slightly soluble in dimethyl sulfoxide; soluble in chloroform; miscible in ethanol, ethyl ether Soluble in alcohol and ether 2% (wt/vol) in water at 20 deg C 1.5 parts by wt (of the formula wt)/100 parts by wt of water In water, 15,000 mg/L at 25 deg C (1.50 g/100 g) |
| Flash Point: | 15.6°C |
| Storage Temperature: | Flammables area |
| Color: | Colorless liquid Clear liquid |
| Safety Data | |
| Hazard Symbols |
T: Toxic
F: Flammable
|
 |
|
