Identification |
Name: | Cellulose diacetate |
Synonyms: | Cellulose diacetate |
CAS: | 9035-69-2 |
Molecular Formula: | C2H4O2 |
Molecular Weight: | 0 |
InChI: | InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4) |
Molecular Structure: |
|
Properties |
Melting Point: | 16.6 deg C |
Flash Point: | 40°C |
Boiling Point: | 117.1°Cat760mmHg |
Density: | 1.068g/cm3 |
Solubility: | Miscible with water, alcohol, glycerol, ether, carbon tetrachloride; practically insoluble in carbon disulfide MISCIBLE WITH ACETONE, BENZENE; SOL IN ALCOHOL |
Specification: |
Cellulose diacetate (CAS No.9035-69-2), its synonyms are Acetic acid ; Acid, Acetic ; Acide acétique .
|
Flash Point: | 40°C |
Color: | Clear, colorless liquid Colorless liquid or crystals (Note: Pure compound is a solid below 62 degrees F). Often used in an aqueous solution). |
Safety Data |
|
|