| Identification | |
| Name: | 1,2-Dimethoxybenzene |
| Synonyms: | 2-Methoxyanisole;Benzene,1,2-dimethoxy-;1, 2-Dimethoxybenzene;Dimethylether pyrokatechinu [Czech];Catechol dimethyl ether;Veratrol;Benzene, 1, 2-dimethoxy-;Benzene, o-dimethoxy-;Pyrocatechol dimethyl ether;Benzene, 1,2-dimethoxy-;O,O-Dimethyl catechol;Brenzkatechindimethylether;Synthol;2-Dimethoxybenzol;o-Dimethoxybenzene;2-Dimethoxybenzene;1,2-Dimethoxybenzene;o-Dimethoxybenzene;Veratrole;Veratrole;1,2-dimethyocy benzene; |
| CAS: | 91-16-7 |
| EINECS: | 202-045-3 |
| Molecular Formula: | C8H10O2 |
| Molecular Weight: | 138.16 |
| InChI: | InChI=1/C8H10O2/c1-9-7-5-3-4-6-8(7)10-2/h3-6H,1-2H3 |
| Molecular Structure: | ![(C8H10O2) 2-Methoxyanisole;Benzene,1,2-dimethoxy-;1, 2-Dimethoxybenzene;Dimethylether pyrokatechinu [Czech];Ca...](https://img.guidechem.com/casimg/91-16-7.gif) |
| Properties | |
| Density: | 1.08 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.533-1.535 |
| Water Solubility: | Slightly soluble |
| Solubility: | Slightly soluble |
| Appearance: | clear liquid |
| HS Code: | 29093090 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | A building block for the organic synthesis of other aromatic compounds. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
