| Identification |
| Name: | quinoxaline |
| Synonyms: | 1,4-Benzodiazine |
| CAS: | 91-19-0 |
| EINECS: | 202-047-4 |
| Molecular Formula: | C8H6N2 |
| Molecular Weight: | 130.15 |
| InChI: | InChI=1/C8H6N2/c1-2-4-8-7(3-1)9-5-6-10-8/h1-6H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs
|
| Density: | 1.124 |
| Stability: | No data. |
| Refractive index: | 1.6231 (20 C) |
| Water Solubility: | SOLUBLE |
| Solubility: | Soluble |
| Appearance: | yellow
solid |
| HS Code: | 29339990 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Usage: | Used in the production of used as dyes, pharmaceuticals and antibiotics. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
