| Identification | |
| Name: | Biphenyl |
| Synonyms: | Diphenyl Mixture; Diphenyl |
| CAS: | 92-52-4 |
| EINECS: | 202-163-5 |
| Molecular Formula: | C12H10 |
| Molecular Weight: | 154.21 |
| InChI: | InChI=1/C12H10/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Density: | 0.992 |
| Stability: | Stable. Combustible. Incompatible with strong oxidising agents. |
| Refractive index: | 1.475 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble |
| Appearance: | White crystals |
| Report: |
EPA Genetic Toxicology Program. Reported in EPA TSCA Inventory. Community Right-To-Know List. |
| Packinggroup: | III |
| HS Code: | 29029030 |
| Color: | White scales Colorless leaflets Pure biphenyl is a white crystalline solid that separates from solvents as plates or monoclinic prismatic crystals. Commercial samples are often slightly yellow or tan in color. |
| Usage: | Fungicide. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
