| Identification |
| Name: | 4-Biphenylcarboxylic acid |
| Synonyms: | 4-Biphenylcarboxylicacid (7CI,8CI);Benzoic acid, p-phenyl- (3CI);[1,1'-Biphenyl]-4-carboxylicacid;4-Carboxy-1,1'-biphenyl;4-Carboxybiphenyl;4-Diphenylcarboxylic acid;4-Phenylbenzoic acid;NSC 23040;p-Biphenylcarboxylic acid;p-Phenylbenzoicacid;4-Biphenylbenzoic acid;p-Phenylbenzoic Acid; |
| CAS: | 92-92-2 |
| EINECS: | 202-203-1 |
| Molecular Formula: | C13H10O2 |
| Molecular Weight: | 198.22 |
| InChI: | InChI=1/C13H10O2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,(H,14,15) |
| Molecular Structure: |
![(C13H10O2) 4-Biphenylcarboxylicacid (7CI,8CI);Benzoic acid, p-phenyl- (3CI);[1,1'-Biphenyl]-4-carboxylicacid;4-...](https://img.guidechem.com/casimg/92-92-2.gif) |
| Properties |
| Flash Point: | 170 |
| Boiling Point: | 373 |
| Density: | 1.284 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | Soluble in alcohol and ether, insoluble in water |
| Solubility: | Soluble |
| Appearance: | Very slightly beige powder. |
| HS Code: | 29163900 |
| Flash Point: | 170 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
