| Identification | |
| Name: | 2-Biphenylcarboxylic acid |
| Synonyms: | 2-Phenylbenzoic acid; 2-Biphenyl carboxylic acid |
| CAS: | 947-84-2 |
| EINECS: | 213-432-1 |
| Molecular Formula: | C13H10O2 |
| Molecular Weight: | 198.22 |
| InChI: | InChI=1/C13H10O2/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H,(H,14,15) |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Density: | 1.185 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | insoluble |
| Solubility: | Insoluble |
| Appearance: | white to off-white crystalline powder |
| Specification: |
2-Biphenylcarboxylic acid , its CAS NO. is 947-84-2, the synonyms are o-Phenylbenzoic acid ; 2-Phenylbenzoic acid . |
| HS Code: | 29163900 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
