| Identification | |
| Name: | 6-Methylpicolinic acid |
| Synonyms: | 6-Methyl-2-picolinic acid |
| CAS: | 934-60-1 |
| EINECS: | 213-287-4 |
| Molecular Formula: | C7H7NO2 |
| Molecular Weight: | 137.14 |
| InChI: | InChI=1/C7H7NO2/c1-5-3-2-4-6(8-5)7(9)10/h2-4H,1H3,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.23 g/cm3 |
| Refractive index: | 1.561 |
| Specification: | White to beige powder Safety Statements:26-36/37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
