| Identification |
| Name: | 9H-Purin-6-amine,N,N-dimethyl- |
| Synonyms: | 1H-Purin-6-amine,N,N-dimethyl- (9CI);Adenine, N,N-dimethyl- (8CI);Adenine, N6,N6-dimethyl-(6CI);Purine, 6-(dimethylamino)- (7CI);6,6-Dimethyladenine;6-(Dimethylamino)purine;6-DMAP;Dimethyladenine;N,N-Dimethyl-6-aminopurine;N,N-Dimethyladenine;N6,N6-Dimethyladenine;NSC401568; |
| CAS: | 938-55-6 |
| EINECS: | 213-344-3 |
| Molecular Formula: | C7H9N5 |
| Molecular Weight: | 163.18 |
| InChI: | InChI=1/C7H9N5/c1-12(2)7-5-6(9-3-8-5)10-4-11-7/h3-4H,1-2H3,(H,8,9,10,11) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2811 6 |
| Density: | 1.365 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.713 |
| Water Solubility: | methanol: 0.1 g/mL, clear |
| Solubility: | methanol: 0.1 g/mL, clear |
| Appearance: | white to light yellow crystal powder |
| Packinggroup: | II; III |
| Storage Temperature: | −20°C |
| Color: | off-white to yellow |
| Usage: | A purine antagonist. In the benzodiazepine receptor (BZR) binding assay, it inhibits the binding of 1.5 nM [3H]diazepam at 100uM in rat brains |
| Safety Data |
| Hazard Symbols |
T+: Very toxic
|
| |
 |
