Identification |
Name: | undecenoic acid, compound with piperazine-1,4-diethanol (1:1) |
Synonyms: | Undecenoic acid, compound with piperazine-1,4-diethanol (1:1);2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol; undec-2-enoic acid |
CAS: | 93882-29-2 |
EINECS: | 299-427-5 |
Molecular Formula: | C19H38N2O4 |
Molecular Weight: | 358.516 |
InChI: | InChI=1/C11H20O2.C8H18N2O2/c1-2-3-4-5-6-7-8-9-10-11(12)13;11-7-5-9-1-2-10(4-3-9)6-8-12/h9-10H,2-8H2,1H3,(H,12,13);11-12H,1-8H2 |
Molecular Structure: |
![(C19H38N2O4) Undecenoic acid, compound with piperazine-1,4-diethanol (1:1);2-[4-(2-hydroxyethyl)piperazin-1-yl]et...](https://img.guidechem.com/pic/image/93882-29-2.gif) |
Properties |
Flash Point: | 280.4°C |
Boiling Point: | 540°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 280.4°C |
Safety Data |
|
 |